C16H26IO7P — CID 10323206
[(Z,3R,4S,5S,8S)-3-hydroxy-1-iodo-4-methyl-8-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]non-1-en-5-yl] dihydrogen phosphate (PubChem CID 10323206) has the molecular formula C16H26IO7P and a molecular weight of 488.26 g/mol. Its IUPAC name is [(Z,3R,4S,5S,8S)-3-hydroxy-1-iodo-4-methyl-8-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]non-1-en-5-yl] dihydrogen phosphate.
| Compound Name | [(Z,3R,4S,5S,8S)-3-hydroxy-1-iodo-4-methyl-8-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]non-1-en-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10323206 |
| Molecular Formula | C16H26IO7P |
| Molecular Weight | 488.26 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | [(Z,3R,4S,5S,8S)-3-hydroxy-1-iodo-4-methyl-8-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]non-1-en-5-yl] dihydrogen phosphate |
| SMILES | C[C@H]([C@H](CC[C@H](C)[C@@H]1OC(=O)C=C[C@@H]1C)OP(=O)(O)O)[C@@H](O)/C=C\I |
| InChI | InChI=1S/C16H26IO7P/c1-10(16-11(2)5-7-15(19)23-16)4-6-14(24-25(20,21)22)12(3)13(18)8-9-17/h5,7-14,16,18H,4,6H2,1-3H3,(H2,20,21,22)/b9-8-/t10-,11-,12-,13-,14-,16-/m0/s1 |
| InChIKey | PHGGIZOGXIZKCI-UOGQGDIMSA-N |
| XLogP | 2.94 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|