C23H22F6N2O3 — CID 10323211
3-[3,5-bis(trifluoromethyl)phenyl]-N-(2-ethoxyethyl)-2-methyl-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 10323211) has the molecular formula C23H22F6N2O3 and a molecular weight of 488.43 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-N-(2-ethoxyethyl)-2-methyl-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-N-(2-ethoxyethyl)-2-methyl-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 10323211 |
| Molecular Formula | C23H22F6N2O3 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-N-(2-ethoxyethyl)-2-methyl-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CCOCCNC(=O)C1c2ccccc2C(=O)N(C)C1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F6N2O3/c1-3-34-9-8-30-20(32)18-16-6-4-5-7-17(16)21(33)31(2)19(18)13-10-14(22(24,25)26)12-15(11-13)23(27,28)29/h4-7,10-12,18-19H,3,8-9H2,1-2H3,(H,30,32) |
| InChIKey | WWWNPSHASDNUKB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|