C14H13Cl2NO3 — CID 103232280
methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate (PubChem CID 103232280) has the molecular formula C14H13Cl2NO3 and a molecular weight of 314.17 g/mol. Its IUPAC name is methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103232280 |
| Molecular Formula | C14H13Cl2NO3 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)Nc2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C14H13Cl2NO3/c1-8(12-5-6-13(20-12)14(18)19-2)17-11-4-3-9(15)7-10(11)16/h3-8,17H,1-2H3 |
| InChIKey | DOKATVVBTBBQNL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |