methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate

C14H13Cl2NO3 — CID 103232280

IUPACmethyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate
SMILESCOC(=O)c1ccc(C(C)Nc2ccc(Cl)cc2Cl)o1
InChIInChI=1S/C14H13Cl2NO3/c1-8(12-5-6-13(20-12)14(18)19-2)17-11-4-3-9(15)7-10(11)16/h3-8,17H,1-2H3
InChIKeyDOKATVVBTBBQNL-UHFFFAOYSA-N
MW314.17 g/mol
LogP4.55
Rot. Bonds4

About methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate

methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate (PubChem CID 103232280) has the molecular formula C14H13Cl2NO3 and a molecular weight of 314.17 g/mol. Its IUPAC name is methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate
PubChem CID103232280
Molecular FormulaC14H13Cl2NO3
Molecular Weight314.17 g/mol
Exact Mass313.03
IUPAC Namemethyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate
SMILESCOC(=O)c1ccc(C(C)Nc2ccc(Cl)cc2Cl)o1
InChIInChI=1S/C14H13Cl2NO3/c1-8(12-5-6-13(20-12)14(18)19-2)17-11-4-3-9(15)7-10(11)16/h3-8,17H,1-2H3
InChIKeyDOKATVVBTBBQNL-UHFFFAOYSA-N
XLogP4.55
TPSA51.47 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.17
LogP ≤ 54.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate (CID 103232280) is methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate is COC(=O)c1ccc(C(C)Nc2ccc(Cl)cc2Cl)o1.
What is the InChIKey of methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate?
The InChIKey is DOKATVVBTBBQNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2NO3/c1-8(12-5-6-13(20-12)14(18)19-2)17-11-4-3-9(15)7-10(11)16/h3-8,17H,1-2H3.
What are the key properties of methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate?
methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate has a molecular weight of 314.17 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[1-(2,4-dichloroanilino)ethyl]furan-2-carboxylate is sourced from PubChem (CID 103232280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).