C23H27FN4O5S — CID 10323287
[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl methanesulfonate (PubChem CID 10323287) has the molecular formula C23H27FN4O5S and a molecular weight of 490.56 g/mol. Its IUPAC name is [6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl methanesulfonate.
| Compound Name | [6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10323287 |
| Molecular Formula | C23H27FN4O5S |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | [6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cccc(OC[C@@H]2CC[C@H]3CN(c4noc5ccc(F)cc45)CCN3C2)n1 |
| InChI | InChI=1S/C23H27FN4O5S/c1-34(29,30)32-15-18-3-2-4-22(25-18)31-14-16-5-7-19-13-28(10-9-27(19)12-16)23-20-11-17(24)6-8-21(20)33-26-23/h2-4,6,8,11,16,19H,5,7,9-10,12-15H2,1H3/t16-,19+/m1/s1 |
| InChIKey | JZVKTPONHCTWPH-APWZRJJASA-N |
| XLogP | 2.82 |
| TPSA | 98.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|