C21H19F6N3O4 — CID 10323328
2,2,2-Trifluoro-N-{2-oxo-6-phenyl-1-[(3,3,3-trifluoro-1-isopropyl-2-oxo-propylcarbamoyl)-methyl]-1,2-dihydro-pyridin-3-yl}-acetamide (PubChem CID 10323328) has the molecular formula C21H19F6N3O4 and a molecular weight of 491.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]-6-phenyl-3-pyridinyl]acetamide.
| Compound Name | 2,2,2-Trifluoro-N-{2-oxo-6-phenyl-1-[(3,3,3-trifluoro-1-isopropyl-2-oxo-propylcarbamoyl)-methyl]-1,2-dihydro-pyridin-3-yl}-acetamide |
|---|---|
| PubChem CID | 10323328 |
| Molecular Formula | C21H19F6N3O4 |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]-6-phenyl-3-pyridinyl]acetamide |
| SMILES | CC(C)C(C(=O)C(F)(F)F)NC(=O)CN1C(=CC=C(C1=O)NC(=O)C(F)(F)F)C2=CC=CC=C2 |
| InChI | InChI=1S/C21H19F6N3O4/c1-11(2)16(17(32)20(22,23)24)29-15(31)10-30-14(12-6-4-3-5-7-12)9-8-13(18(30)33)28-19(34)21(25,26)27/h3-9,11,16H,10H2,1-2H3,(H,28,34)(H,29,31) |
| InChIKey | HQOLYAHAXMEHSL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | 886 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |