C12H24N2O2 — CID 103233776
(E)-3-[5-(diethylamino)pentan-2-ylamino]prop-2-enoic acid (PubChem CID 103233776) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (E)-3-[5-(diethylamino)pentan-2-ylamino]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(diethylamino)pentan-2-ylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 103233776 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | (E)-3-[5-(diethylamino)pentan-2-ylamino]prop-2-enoic acid |
| SMILES | CCN(CC)CCCC(C)N/C=C/C(=O)O |
| InChI | InChI=1S/C12H24N2O2/c1-4-14(5-2)10-6-7-11(3)13-9-8-12(15)16/h8-9,11,13H,4-7,10H2,1-3H3,(H,15,16)/b9-8+ |
| InChIKey | RVLVRVVDEPXSJS-CMDGGOBGSA-N |
| XLogP | 1.68 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|