About methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate
methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate (PubChem CID 103234700) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate.
Molecular Properties
| Compound Name | methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate |
| PubChem CID | 103234700 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate |
| SMILES | CCC(=CCNC1CCCC(C)C1C)C(=O)OC |
| InChI | InChI=1S/C15H27NO2/c1-5-13(15(17)18-4)9-10-16-14-8-6-7-11(2)12(14)3/h9,11-12,14,16H,5-8,10H2,1-4H3 |
| InChIKey | FFDCNOCOXYWPFN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate?
The IUPAC name of methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate (CID 103234700) is methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate.
What is the SMILES notation for methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate?
The canonical SMILES for methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate is CCC(=CCNC1CCCC(C)C1C)C(=O)OC.
What is the InChIKey of methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate?
The InChIKey is FFDCNOCOXYWPFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2/c1-5-13(15(17)18-4)9-10-16-14-8-6-7-11(2)12(14)3/h9,11-12,14,16H,5-8,10H2,1-4H3.
What are the key properties of methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate?
methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate has a molecular weight of 253.39 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2,3-dimethylcyclohexyl)amino]-2-ethylbut-2-enoate is sourced from PubChem (CID 103234700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).