3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid

C7H10F3NO2 — CID 103235308

IUPAC3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid
SMILESCC(=CC(=O)O)CNCC(F)(F)F
InChIInChI=1S/C7H10F3NO2/c1-5(2-6(12)13)3-11-4-7(8,9)10/h2,11H,3-4H2,1H3,(H,12,13)
InChIKeyFBQFZFDDYMAVPE-UHFFFAOYSA-N
MW197.16 g/mol
LogP1.17
Rot. Bonds4

About 3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid

3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid (PubChem CID 103235308) has the molecular formula C7H10F3NO2 and a molecular weight of 197.16 g/mol. Its IUPAC name is 3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid.

Molecular Properties

Compound Name3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid
PubChem CID103235308
Molecular FormulaC7H10F3NO2
Molecular Weight197.16 g/mol
Exact Mass197.07
IUPAC Name3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid
SMILESCC(=CC(=O)O)CNCC(F)(F)F
InChIInChI=1S/C7H10F3NO2/c1-5(2-6(12)13)3-11-4-7(8,9)10/h2,11H,3-4H2,1H3,(H,12,13)
InChIKeyFBQFZFDDYMAVPE-UHFFFAOYSA-N
XLogP1.17
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.16
LogP ≤ 51.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid?
The IUPAC name of 3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid (CID 103235308) is 3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid.
What is the SMILES notation for 3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid?
The canonical SMILES for 3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid is CC(=CC(=O)O)CNCC(F)(F)F.
What is the InChIKey of 3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid?
The InChIKey is FBQFZFDDYMAVPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F3NO2/c1-5(2-6(12)13)3-11-4-7(8,9)10/h2,11H,3-4H2,1H3,(H,12,13).
What are the key properties of 3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid?
3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid has a molecular weight of 197.16 g/mol, XLogP of 1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(2,2,2-trifluoroethylamino)but-2-enoic acid is sourced from PubChem (CID 103235308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).