C31H54B2O3 — CID 10323544
[(3S,4S)-4-(1,3,2-dioxaborinan-2-yl)-2,2-dimethylhex-5-en-3-yl]oxy-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane (PubChem CID 10323544) has the molecular formula C31H54B2O3 and a molecular weight of 496.39 g/mol. Its IUPAC name is [(3S,4S)-4-(1,3,2-dioxaborinan-2-yl)-2,2-dimethylhex-5-en-3-yl]oxy-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | [(3S,4S)-4-(1,3,2-dioxaborinan-2-yl)-2,2-dimethylhex-5-en-3-yl]oxy-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 10323544 |
| Molecular Formula | C31H54B2O3 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 496.43 |
| IUPAC Name | [(3S,4S)-4-(1,3,2-dioxaborinan-2-yl)-2,2-dimethylhex-5-en-3-yl]oxy-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| SMILES | C=C[C@H](B1OCCCO1)[C@H](OB([C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C)[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C31H54B2O3/c1-11-25(33-34-13-12-14-35-33)28(29(4,5)6)36-32(26-17-21-15-23(19(26)2)30(21,7)8)27-18-22-16-24(20(27)3)31(22,9)10/h11,19-28H,1,12-18H2,2-10H3/t19-,20-,21+,22+,23-,24-,25+,26-,27-,28+/m1/s1 |
| InChIKey | AHULOSUCUYHAGG-XCGJTIDPSA-N |
| XLogP | 8.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|