About 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate
2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate (PubChem CID 10323547) has the molecular formula C22H25N5O2S
and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate.
Molecular Properties
| Compound Name | 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate |
| PubChem CID | 10323547 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(-c2[nH]c3cc(/C(N)=N/[H])ccc3c2CC(=O)OCCSCC)cc1 |
| InChI | InChI=1S/C22H25N5O2S/c1-2-30-10-9-29-19(28)12-17-16-8-7-15(22(25)26)11-18(16)27-20(17)13-3-5-14(6-4-13)21(23)24/h3-8,11,27H,2,9-10,12H2,1H3,(H3,23,24)(H3,25,26) |
| InChIKey | AVVNSKIVKCUPOR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate?
The IUPAC name of 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate (CID 10323547) is 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate.
What is the SMILES notation for 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate?
The canonical SMILES for 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate is [H]/N=C(\N)c1ccc(-c2[nH]c3cc(/C(N)=N/[H])ccc3c2CC(=O)OCCSCC)cc1.
What is the InChIKey of 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate?
The InChIKey is AVVNSKIVKCUPOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5O2S/c1-2-30-10-9-29-19(28)12-17-16-8-7-15(22(25)26)11-18(16)27-20(17)13-3-5-14(6-4-13)21(23)24/h3-8,11,27H,2,9-10,12H2,1H3,(H3,23,24)(H3,25,26).
What are the key properties of 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate?
2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate has a molecular weight of 423.54 g/mol, XLogP of 3.24, 9 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanylethyl 2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetate is sourced from PubChem (CID 10323547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).