C14H19NO2 — CID 103235708
methyl (E)-4-(3,5-dimethylanilino)-2-methylbut-2-enoate (PubChem CID 103235708) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is methyl (E)-4-(3,5-dimethylanilino)-2-methylbut-2-enoate.
| Compound Name | methyl (E)-4-(3,5-dimethylanilino)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 103235708 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | methyl (E)-4-(3,5-dimethylanilino)-2-methylbut-2-enoate |
| SMILES | COC(=O)/C(C)=C/CNc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H19NO2/c1-10-7-11(2)9-13(8-10)15-6-5-12(3)14(16)17-4/h5,7-9,15H,6H2,1-4H3/b12-5+ |
| InChIKey | HZVBOVGCSVDTPG-LFYBBSHMSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|