C26H44N2O7 — CID 10323571
3-[[(2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanoyl]amino]propanoic acid (PubChem CID 10323571) has the molecular formula C26H44N2O7 and a molecular weight of 496.65 g/mol. Its IUPAC name is 3-[[(2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanoyl]amino]propanoic acid.
| Compound Name | 3-[[(2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10323571 |
| Molecular Formula | C26H44N2O7 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | 3-[[(2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanoyl]amino]propanoic acid |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@@H](C)C(=O)NCCC(=O)O)C(C)C)ccc1OC |
| InChI | InChI=1S/C26H44N2O7/c1-17(2)20(14-19-7-8-23(34-5)24(15-19)35-12-6-11-33-4)16-21(27)22(29)13-18(3)26(32)28-10-9-25(30)31/h7-8,15,17-18,20-22,29H,6,9-14,16,27H2,1-5H3,(H,28,32)(H,30,31)/t18-,20+,21+,22+/m1/s1 |
| InChIKey | PFOILAKVXXLGPQ-GBAJDQEWSA-N |
| XLogP | 2.62 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|