C17H18FNO2 — CID 103235860
2-[4-[(3-fluoro-4-methylanilino)methyl]phenyl]propanoic acid (PubChem CID 103235860) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is 2-[4-[(3-fluoro-4-methylanilino)methyl]phenyl]propanoic acid.
| Compound Name | 2-[4-[(3-fluoro-4-methylanilino)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 103235860 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-[4-[(3-fluoro-4-methylanilino)methyl]phenyl]propanoic acid |
| SMILES | Cc1ccc(NCc2ccc(C(C)C(=O)O)cc2)cc1F |
| InChI | InChI=1S/C17H18FNO2/c1-11-3-8-15(9-16(11)18)19-10-13-4-6-14(7-5-13)12(2)17(20)21/h3-9,12,19H,10H2,1-2H3,(H,20,21) |
| InChIKey | ZJAGIZYBOWFAIN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |