C16H16FNO2 — CID 103236050
2-[4-[(4-fluoro-2-methylanilino)methyl]phenyl]acetic acid (PubChem CID 103236050) has the molecular formula C16H16FNO2 and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-[4-[(4-fluoro-2-methylanilino)methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(4-fluoro-2-methylanilino)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 103236050 |
| Molecular Formula | C16H16FNO2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-[4-[(4-fluoro-2-methylanilino)methyl]phenyl]acetic acid |
| SMILES | Cc1cc(F)ccc1NCc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C16H16FNO2/c1-11-8-14(17)6-7-15(11)18-10-13-4-2-12(3-5-13)9-16(19)20/h2-8,18H,9-10H2,1H3,(H,19,20) |
| InChIKey | XNNJHIWLWQTVOE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |