3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid

C15H13F2NO3 — CID 103236084

IUPAC3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid
SMILESO=C(O)c1cccc(OCCNc2cc(F)cc(F)c2)c1
InChIInChI=1S/C15H13F2NO3/c16-11-7-12(17)9-13(8-11)18-4-5-21-14-3-1-2-10(6-14)15(19)20/h1-3,6-9,18H,4-5H2,(H,19,20)
InChIKeyRSIILJKTRZGRMH-UHFFFAOYSA-N
MW293.27 g/mol
LogP3.15
Rot. Bonds6

About 3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid

3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid (PubChem CID 103236084) has the molecular formula C15H13F2NO3 and a molecular weight of 293.27 g/mol. Its IUPAC name is 3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid.

Molecular Properties

Compound Name3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid
PubChem CID103236084
Molecular FormulaC15H13F2NO3
Molecular Weight293.27 g/mol
Exact Mass293.09
IUPAC Name3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid
SMILESO=C(O)c1cccc(OCCNc2cc(F)cc(F)c2)c1
InChIInChI=1S/C15H13F2NO3/c16-11-7-12(17)9-13(8-11)18-4-5-21-14-3-1-2-10(6-14)15(19)20/h1-3,6-9,18H,4-5H2,(H,19,20)
InChIKeyRSIILJKTRZGRMH-UHFFFAOYSA-N
XLogP3.15
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.27
LogP ≤ 53.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-[2-(3-fluoroanilino)ethoxy]benzoic acid
CID 103234227
3-[2-(4-bromoanilino)ethoxy]benzoic acid
CID 103234418
3-[2-(4-iodoanilino)ethoxy]benzoic acid
CID 103236759
3-[2-(4-methoxyanilino)ethoxy]benzoic acid
CID 103234904
3-[2-(pyrimidin-2-ylamino)ethoxy]benzoic acid
CID 98039259
3-[2-(3-methylphenoxy)ethylamino]benzoic acid
CID 82096040
3-(3-phenoxypropylamino)benzoic acid
CID 82096044
3-[2-(2-fluoro-4-methylanilino)ethoxy]benzoic acid
CID 103236314
3-[2-(propylamino)ethoxy]benzoic acid
CID 103235092
3-[2-(4-chlorophenoxy)ethylamino]benzoic acid
CID 82096042
3-[2-(5-bromo-2-methylanilino)ethoxy]benzoic acid
CID 103239501
3-[2-(2-bromo-3-chloroanilino)ethoxy]benzoic acid
CID 103480477

Frequently Asked Questions

What is the IUPAC name of 3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid?
The IUPAC name of 3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid (CID 103236084) is 3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid.
What is the SMILES notation for 3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid?
The canonical SMILES for 3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid is O=C(O)c1cccc(OCCNc2cc(F)cc(F)c2)c1.
What is the InChIKey of 3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid?
The InChIKey is RSIILJKTRZGRMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2NO3/c16-11-7-12(17)9-13(8-11)18-4-5-21-14-3-1-2-10(6-14)15(19)20/h1-3,6-9,18H,4-5H2,(H,19,20).
What are the key properties of 3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid?
3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid has a molecular weight of 293.27 g/mol, XLogP of 3.15, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,5-difluoroanilino)ethoxy]benzoic acid is sourced from PubChem (CID 103236084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).