C11H14ClNO3 — CID 103236425
4-(2-chloro-4-methylanilino)-3-hydroxybutanoic acid (PubChem CID 103236425) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 4-(2-chloro-4-methylanilino)-3-hydroxybutanoic acid.
| Compound Name | 4-(2-chloro-4-methylanilino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 103236425 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 4-(2-chloro-4-methylanilino)-3-hydroxybutanoic acid |
| SMILES | Cc1ccc(NCC(O)CC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClNO3/c1-7-2-3-10(9(12)4-7)13-6-8(14)5-11(15)16/h2-4,8,13-14H,5-6H2,1H3,(H,15,16) |
| InChIKey | WLZAOQGFPPSRSK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |