C10H7Cl3F3NO2 — CID 103236902
3,3,3-trifluoro-2-[(2,4,6-trichloroanilino)methyl]propanoic acid (PubChem CID 103236902) has the molecular formula C10H7Cl3F3NO2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(2,4,6-trichloroanilino)methyl]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-[(2,4,6-trichloroanilino)methyl]propanoic acid |
|---|---|
| PubChem CID | 103236902 |
| Molecular Formula | C10H7Cl3F3NO2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | 3,3,3-trifluoro-2-[(2,4,6-trichloroanilino)methyl]propanoic acid |
| SMILES | O=C(O)C(CNc1c(Cl)cc(Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C10H7Cl3F3NO2/c11-4-1-6(12)8(7(13)2-4)17-3-5(9(18)19)10(14,15)16/h1-2,5,17H,3H2,(H,18,19) |
| InChIKey | HDHZZNQQAPLLSB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |