2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid

C10H17NO2 — CID 103237760

IUPAC2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid
SMILESC=C(CNCC1CCCC1)C(=O)O
InChIInChI=1S/C10H17NO2/c1-8(10(12)13)6-11-7-9-4-2-3-5-9/h9,11H,1-7H2,(H,12,13)
InChIKeyLPMFGLWYTHQICU-UHFFFAOYSA-N
MW183.25 g/mol
LogP1.41
Rot. Bonds5

About 2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid

2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid (PubChem CID 103237760) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid.

Molecular Properties

Compound Name2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid
PubChem CID103237760
Molecular FormulaC10H17NO2
Molecular Weight183.25 g/mol
Exact Mass183.13
IUPAC Name2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid
SMILESC=C(CNCC1CCCC1)C(=O)O
InChIInChI=1S/C10H17NO2/c1-8(10(12)13)6-11-7-9-4-2-3-5-9/h9,11H,1-7H2,(H,12,13)
InChIKeyLPMFGLWYTHQICU-UHFFFAOYSA-N
XLogP1.41
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.25
LogP ≤ 51.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[(Pentylamino)methyl]prop-2-enoic acid
CID 87503709
2-[(Heptylamino)methyl]prop-2-enoic acid
CID 87503931
2-[(Hexylamino)methyl]prop-2-enoic acid
CID 87504774
2-[(Octylamino)methyl]prop-2-enoic acid
CID 87504841
2-[[Cyclopentylmethyl(methyl)amino]methyl]prop-2-enoic acid
CID 64115483
2-[(Cyclopentylamino)methyl]prop-2-enoic acid
CID 103231082
2-[(3-Methylbutylamino)methyl]prop-2-enoic acid
CID 103233297
2-[[(4-Methylcyclohexyl)amino]methyl]prop-2-enoic acid
CID 103234013
2-[[(2-Methylcyclohexyl)amino]methyl]prop-2-enoic acid
CID 103235511
2-[(Cyclobutylmethylamino)methyl]prop-2-enoic acid
CID 103237446
2-[(4-Methylpentan-2-ylamino)methyl]prop-2-enoic acid
CID 103237668
2-[[(3-Methylcyclohexyl)amino]methyl]prop-2-enoic acid
CID 103237713

Frequently Asked Questions

What is the IUPAC name of 2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid?
The IUPAC name of 2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid (CID 103237760) is 2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid.
What is the SMILES notation for 2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid?
The canonical SMILES for 2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid is C=C(CNCC1CCCC1)C(=O)O.
What is the InChIKey of 2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid?
The InChIKey is LPMFGLWYTHQICU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-8(10(12)13)6-11-7-9-4-2-3-5-9/h9,11H,1-7H2,(H,12,13).
What are the key properties of 2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid?
2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid has a molecular weight of 183.25 g/mol, XLogP of 1.41, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(cyclopentylmethylamino)methyl]prop-2-enoic acid is sourced from PubChem (CID 103237760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).