C14H16N2O3S — CID 103238424
3-[[[2-(ethylamino)-2-oxoethyl]amino]methyl]-1-benzothiophene-2-carboxylic acid (PubChem CID 103238424) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-[[[2-(ethylamino)-2-oxoethyl]amino]methyl]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-[[[2-(ethylamino)-2-oxoethyl]amino]methyl]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103238424 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-[[[2-(ethylamino)-2-oxoethyl]amino]methyl]-1-benzothiophene-2-carboxylic acid |
| SMILES | CCNC(=O)CNCc1c(C(=O)O)sc2ccccc12 |
| InChI | InChI=1S/C14H16N2O3S/c1-2-16-12(17)8-15-7-10-9-5-3-4-6-11(9)20-13(10)14(18)19/h3-6,15H,2,7-8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | XJEVBLBMBHECIF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |