C10H14N2O4 — CID 103238811
5-[[(3-amino-3-oxopropyl)amino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 103238811) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 5-[[(3-amino-3-oxopropyl)amino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[(3-amino-3-oxopropyl)amino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 103238811 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 5-[[(3-amino-3-oxopropyl)amino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CNCCC(N)=O)cc1C(=O)O |
| InChI | InChI=1S/C10H14N2O4/c1-6-8(10(14)15)4-7(16-6)5-12-3-2-9(11)13/h4,12H,2-3,5H2,1H3,(H2,11,13)(H,14,15) |
| InChIKey | QDGZPFZMYBLNPV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|