C9H15BrN2O3 — CID 103239136
methyl 2-bromo-3-[[2-(cyclopropylamino)-2-oxoethyl]amino]propanoate (PubChem CID 103239136) has the molecular formula C9H15BrN2O3 and a molecular weight of 279.13 g/mol. Its IUPAC name is methyl 2-bromo-3-[[2-(cyclopropylamino)-2-oxoethyl]amino]propanoate.
| Compound Name | methyl 2-bromo-3-[[2-(cyclopropylamino)-2-oxoethyl]amino]propanoate |
|---|---|
| PubChem CID | 103239136 |
| Molecular Formula | C9H15BrN2O3 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | methyl 2-bromo-3-[[2-(cyclopropylamino)-2-oxoethyl]amino]propanoate |
| SMILES | COC(=O)C(Br)CNCC(=O)NC1CC1 |
| InChI | InChI=1S/C9H15BrN2O3/c1-15-9(14)7(10)4-11-5-8(13)12-6-2-3-6/h6-7,11H,2-5H2,1H3,(H,12,13) |
| InChIKey | LQPFEYVPLLARKR-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|