C13H15BrF3NO3 — CID 103239533
ethyl 4-[4-bromo-2-(trifluoromethyl)anilino]-3-hydroxybutanoate (PubChem CID 103239533) has the molecular formula C13H15BrF3NO3 and a molecular weight of 370.17 g/mol. Its IUPAC name is ethyl 4-[4-bromo-2-(trifluoromethyl)anilino]-3-hydroxybutanoate.
| Compound Name | ethyl 4-[4-bromo-2-(trifluoromethyl)anilino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 103239533 |
| Molecular Formula | C13H15BrF3NO3 |
| Molecular Weight | 370.17 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | ethyl 4-[4-bromo-2-(trifluoromethyl)anilino]-3-hydroxybutanoate |
| SMILES | CCOC(=O)CC(O)CNc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15BrF3NO3/c1-2-21-12(20)6-9(19)7-18-11-4-3-8(14)5-10(11)13(15,16)17/h3-5,9,18-19H,2,6-7H2,1H3 |
| InChIKey | ZBWDFNPREXKITB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.17 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |