C11H16N2O3 — CID 103239880
3-hydroxy-4-(2-pyridin-3-ylethylamino)butanoic acid (PubChem CID 103239880) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-hydroxy-4-(2-pyridin-3-ylethylamino)butanoic acid.
| Compound Name | 3-hydroxy-4-(2-pyridin-3-ylethylamino)butanoic acid |
|---|---|
| PubChem CID | 103239880 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-hydroxy-4-(2-pyridin-3-ylethylamino)butanoic acid |
| SMILES | O=C(O)CC(O)CNCCc1cccnc1 |
| InChI | InChI=1S/C11H16N2O3/c14-10(6-11(15)16)8-13-5-3-9-2-1-4-12-7-9/h1-2,4,7,10,13-14H,3,5-6,8H2,(H,15,16) |
| InChIKey | XZYUQAQDWLCAEY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|