About 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid
2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 103240054) has the molecular formula C11H18F3NO2
and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid.
Molecular Properties
| Compound Name | 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid |
| PubChem CID | 103240054 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid |
| SMILES | O=C(O)C(CNCCC1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H18F3NO2/c12-11(13,14)9(10(16)17)7-15-6-5-8-3-1-2-4-8/h8-9,15H,1-7H2,(H,16,17) |
| InChIKey | VEQWQHYIOCCPRM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid?
The IUPAC name of 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid (CID 103240054) is 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid.
What is the SMILES notation for 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid?
The canonical SMILES for 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid is O=C(O)C(CNCCC1CCCC1)C(F)(F)F.
What is the InChIKey of 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid?
The InChIKey is VEQWQHYIOCCPRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO2/c12-11(13,14)9(10(16)17)7-15-6-5-8-3-1-2-4-8/h8-9,15H,1-7H2,(H,16,17).
What are the key properties of 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid?
2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid has a molecular weight of 253.26 g/mol, XLogP of 2.42, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-cyclopentylethylamino)methyl]-3,3,3-trifluoropropanoic acid is sourced from PubChem (CID 103240054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).