C30H44N4O3 — CID 10324013
3-(ethylamino)-N-[(2S,3R)-3-hydroxy-4-(5-methylhexylamino)-1-phenylbutan-2-yl]-5-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 10324013) has the molecular formula C30H44N4O3 and a molecular weight of 508.71 g/mol. Its IUPAC name is 3-(ethylamino)-N-[(2S,3R)-3-hydroxy-4-(5-methylhexylamino)-1-phenylbutan-2-yl]-5-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | 3-(ethylamino)-N-[(2S,3R)-3-hydroxy-4-(5-methylhexylamino)-1-phenylbutan-2-yl]-5-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 10324013 |
| Molecular Formula | C30H44N4O3 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | 3-(ethylamino)-N-[(2S,3R)-3-hydroxy-4-(5-methylhexylamino)-1-phenylbutan-2-yl]-5-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CCNc1cc(C(=O)N[C@@H](Cc2ccccc2)[C@H](O)CNCCCCC(C)C)cc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C30H44N4O3/c1-4-32-25-18-24(19-26(20-25)34-16-10-14-29(34)36)30(37)33-27(17-23-12-6-5-7-13-23)28(35)21-31-15-9-8-11-22(2)3/h5-7,12-13,18-20,22,27-28,31-32,35H,4,8-11,14-17,21H2,1-3H3,(H,33,37)/t27-,28+/m0/s1 |
| InChIKey | KDFMFNIYGTUGIZ-WUFINQPMSA-N |
| XLogP | 4.36 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|