C10H10F4N2O2 — CID 103240401
2-cyclopropyl-4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one (PubChem CID 103240401) has the molecular formula C10H10F4N2O2 and a molecular weight of 266.19 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103240401 |
| Molecular Formula | C10H10F4N2O2 |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-cyclopropyl-4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(OCC(F)(F)C(F)F)nc(C2CC2)[nH]1 |
| InChI | InChI=1S/C10H10F4N2O2/c11-9(12)10(13,14)4-18-7-3-6(17)15-8(16-7)5-1-2-5/h3,5,9H,1-2,4H2,(H,15,16,17) |
| InChIKey | KVBAZDWBTJUSMZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|