C7H6F4N2O2 — CID 103240406
4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one (PubChem CID 103240406) has the molecular formula C7H6F4N2O2 and a molecular weight of 226.13 g/mol. Its IUPAC name is 4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103240406 |
| Molecular Formula | C7H6F4N2O2 |
| Molecular Weight | 226.13 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(OCC(F)(F)C(F)F)nc[nH]1 |
| InChI | InChI=1S/C7H6F4N2O2/c8-6(9)7(10,11)2-15-5-1-4(14)12-3-13-5/h1,3,6H,2H2,(H,12,13,14) |
| InChIKey | HFADDDKSHRTIJA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.13 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|