C16H24N2O2 — CID 103240441
2-cyclopropyl-4-(3,3,5-trimethylcyclohexyl)oxy-1H-pyrimidin-6-one (PubChem CID 103240441) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-cyclopropyl-4-(3,3,5-trimethylcyclohexyl)oxy-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-(3,3,5-trimethylcyclohexyl)oxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103240441 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-cyclopropyl-4-(3,3,5-trimethylcyclohexyl)oxy-1H-pyrimidin-6-one |
| SMILES | CC1CC(Oc2cc(=O)[nH]c(C3CC3)n2)CC(C)(C)C1 |
| InChI | InChI=1S/C16H24N2O2/c1-10-6-12(9-16(2,3)8-10)20-14-7-13(19)17-15(18-14)11-4-5-11/h7,10-12H,4-6,8-9H2,1-3H3,(H,17,18,19) |
| InChIKey | FWFKLTSHHAYKQA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |