C9H9F3N2O2 — CID 103240545
2-cyclopropyl-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one (PubChem CID 103240545) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103240545 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-cyclopropyl-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(OCC(F)(F)F)nc(C2CC2)[nH]1 |
| InChI | InChI=1S/C9H9F3N2O2/c10-9(11,12)4-16-7-3-6(15)13-8(14-7)5-1-2-5/h3,5H,1-2,4H2,(H,13,14,15) |
| InChIKey | CVOSCMXXUGRXJK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |