C6H9N3O3 — CID 103240753
5-amino-4-(2-hydroxyethoxy)-1H-pyrimidin-6-one (PubChem CID 103240753) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is 5-amino-4-(2-hydroxyethoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(2-hydroxyethoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103240753 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 5-amino-4-(2-hydroxyethoxy)-1H-pyrimidin-6-one |
| SMILES | Nc1c(OCCO)nc[nH]c1=O |
| InChI | InChI=1S/C6H9N3O3/c7-4-5(11)8-3-9-6(4)12-2-1-10/h3,10H,1-2,7H2,(H,8,9,11) |
| InChIKey | BAOIBCAHBXVAED-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |