C12H21NO2 — CID 103240771
(E)-3-[(4-ethylcyclohexyl)methylamino]prop-2-enoic acid (PubChem CID 103240771) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (E)-3-[(4-ethylcyclohexyl)methylamino]prop-2-enoic acid.
| Compound Name | (E)-3-[(4-ethylcyclohexyl)methylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 103240771 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (E)-3-[(4-ethylcyclohexyl)methylamino]prop-2-enoic acid |
| SMILES | CCC1CCC(CN/C=C/C(=O)O)CC1 |
| InChI | InChI=1S/C12H21NO2/c1-2-10-3-5-11(6-4-10)9-13-8-7-12(14)15/h7-8,10-11,13H,2-6,9H2,1H3,(H,14,15)/b8-7+ |
| InChIKey | FQBDUDOGKWMHHN-BQYQJAHWSA-N |
| XLogP | 2.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|