C32H38N4O2 — CID 10324082
N-methyl-4-phenyl-N-[(3S)-1-[3-(3-phenylpropylamino)pyrrolidine-1-carbonyl]pyrrolidin-3-yl]benzamide (PubChem CID 10324082) has the molecular formula C32H38N4O2 and a molecular weight of 510.68 g/mol. Its IUPAC name is N-methyl-4-phenyl-N-[(3S)-1-[3-(3-phenylpropylamino)pyrrolidine-1-carbonyl]pyrrolidin-3-yl]benzamide.
| Compound Name | N-methyl-4-phenyl-N-[(3S)-1-[3-(3-phenylpropylamino)pyrrolidine-1-carbonyl]pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 10324082 |
| Molecular Formula | C32H38N4O2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | N-methyl-4-phenyl-N-[(3S)-1-[3-(3-phenylpropylamino)pyrrolidine-1-carbonyl]pyrrolidin-3-yl]benzamide |
| SMILES | CN(C(=O)c1ccc(-c2ccccc2)cc1)[C@H]1CCN(C(=O)N2CCC(NCCCc3ccccc3)C2)C1 |
| InChI | InChI=1S/C32H38N4O2/c1-34(31(37)28-16-14-27(15-17-28)26-12-6-3-7-13-26)30-19-22-36(24-30)32(38)35-21-18-29(23-35)33-20-8-11-25-9-4-2-5-10-25/h2-7,9-10,12-17,29-30,33H,8,11,18-24H2,1H3/t29?,30-/m0/s1 |
| InChIKey | BMXFLWHGBTZBRM-ZSXSBBPPSA-N |
| XLogP | 4.92 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|