C9H11N3O2 — CID 103241066
(E)-3-[(2-methylpyrimidin-4-yl)methylamino]prop-2-enoic acid (PubChem CID 103241066) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is (E)-3-[(2-methylpyrimidin-4-yl)methylamino]prop-2-enoic acid.
| Compound Name | (E)-3-[(2-methylpyrimidin-4-yl)methylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 103241066 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (E)-3-[(2-methylpyrimidin-4-yl)methylamino]prop-2-enoic acid |
| SMILES | Cc1nccc(CN/C=C/C(=O)O)n1 |
| InChI | InChI=1S/C9H11N3O2/c1-7-11-5-2-8(12-7)6-10-4-3-9(13)14/h2-5,10H,6H2,1H3,(H,13,14)/b4-3+ |
| InChIKey | LXQYBLMAWCCCII-ONEGZZNKSA-N |
| XLogP | 0.47 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|