C15H13Br3O5 — CID 10324137
3,4-dibromo-5-[[2-bromo-3,4-dihydroxy-6-(methoxymethyl)phenyl]methyl]benzene-1,2-diol (PubChem CID 10324137) has the molecular formula C15H13Br3O5 and a molecular weight of 512.98 g/mol. Its IUPAC name is 3,4-dibromo-5-[[2-bromo-3,4-dihydroxy-6-(methoxymethyl)phenyl]methyl]benzene-1,2-diol.
| Compound Name | 3,4-dibromo-5-[[2-bromo-3,4-dihydroxy-6-(methoxymethyl)phenyl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 10324137 |
| Molecular Formula | C15H13Br3O5 |
| Molecular Weight | 512.98 g/mol |
| Exact Mass | 509.83 |
| IUPAC Name | 3,4-dibromo-5-[[2-bromo-3,4-dihydroxy-6-(methoxymethyl)phenyl]methyl]benzene-1,2-diol |
| SMILES | COCc1cc(O)c(O)c(Br)c1Cc1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C15H13Br3O5/c1-23-5-7-4-10(20)14(21)12(17)8(7)2-6-3-9(19)15(22)13(18)11(6)16/h3-4,19-22H,2,5H2,1H3 |
| InChIKey | IPYUYPHYIFALPM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.98 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|