About methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate
methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate (PubChem CID 103241462) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate |
| PubChem CID | 103241462 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NCc1nc(C)no1 |
| InChI | InChI=1S/C8H11N3O3/c1-6-10-7(14-11-6)5-9-4-3-8(12)13-2/h3-4,9H,5H2,1-2H3/b4-3+ |
| InChIKey | ZIFRHDWXGVNGML-ONEGZZNKSA-N |
| XLogP | 0.15 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate?
The IUPAC name of methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate (CID 103241462) is methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate.
What is the SMILES notation for methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate?
The canonical SMILES for methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate is COC(=O)/C=C/NCc1nc(C)no1.
What is the InChIKey of methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate?
The InChIKey is ZIFRHDWXGVNGML-ONEGZZNKSA-N. The full InChI is InChI=1S/C8H11N3O3/c1-6-10-7(14-11-6)5-9-4-3-8(12)13-2/h3-4,9H,5H2,1-2H3/b4-3+.
What are the key properties of methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate?
methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate has a molecular weight of 197.19 g/mol, XLogP of 0.15, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]prop-2-enoate is sourced from PubChem (CID 103241462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).