C10H20N2O4S — CID 103241568
2-[[3-[ethyl(methylsulfonyl)amino]propylamino]methyl]prop-2-enoic acid (PubChem CID 103241568) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-[[3-[ethyl(methylsulfonyl)amino]propylamino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[3-[ethyl(methylsulfonyl)amino]propylamino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103241568 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-[[3-[ethyl(methylsulfonyl)amino]propylamino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNCCCN(CC)S(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C10H20N2O4S/c1-4-12(17(3,15)16)7-5-6-11-8-9(2)10(13)14/h11H,2,4-8H2,1,3H3,(H,13,14) |
| InChIKey | LIMLZDYDUFCQLR-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|