About 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one
5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one (PubChem CID 103241595) has the molecular formula C10H7F2N3O2
and a molecular weight of 239.18 g/mol. Its IUPAC name is 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one |
| PubChem CID | 103241595 |
| Molecular Formula | C10H7F2N3O2 |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one |
| SMILES | Nc1c(Oc2cc(F)cc(F)c2)nc[nH]c1=O |
| InChI | InChI=1S/C10H7F2N3O2/c11-5-1-6(12)3-7(2-5)17-10-8(13)9(16)14-4-15-10/h1-4H,13H2,(H,14,15,16) |
| InChIKey | RBBAHVLCNZXPFE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one?
The IUPAC name of 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one (CID 103241595) is 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one?
The canonical SMILES for 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one is Nc1c(Oc2cc(F)cc(F)c2)nc[nH]c1=O.
What is the InChIKey of 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one?
The InChIKey is RBBAHVLCNZXPFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2N3O2/c11-5-1-6(12)3-7(2-5)17-10-8(13)9(16)14-4-15-10/h1-4H,13H2,(H,14,15,16).
What are the key properties of 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one?
5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one has a molecular weight of 239.18 g/mol, XLogP of 1.42, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-(3,5-difluorophenoxy)-1H-pyrimidin-6-one is sourced from PubChem (CID 103241595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).