C10H16N2O2 — CID 103241778
4-(3,3-dimethylbutoxy)-1H-pyrimidin-6-one (PubChem CID 103241778) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-(3,3-dimethylbutoxy)-1H-pyrimidin-6-one.
| Compound Name | 4-(3,3-dimethylbutoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241778 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4-(3,3-dimethylbutoxy)-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)CCOc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C10H16N2O2/c1-10(2,3)4-5-14-9-6-8(13)11-7-12-9/h6-7H,4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | JQRWNVCZUASTKD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |