C7H6F5N3O2 — CID 103241782
5-amino-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one (PubChem CID 103241782) has the molecular formula C7H6F5N3O2 and a molecular weight of 259.13 g/mol. Its IUPAC name is 5-amino-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241782 |
| Molecular Formula | C7H6F5N3O2 |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 5-amino-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one |
| SMILES | Nc1c(OCC(F)(F)C(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C7H6F5N3O2/c8-6(9,7(10,11)12)1-17-5-3(13)4(16)14-2-15-5/h2H,1,13H2,(H,14,15,16) |
| InChIKey | SCBVUZYNFHNLOP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|