C7H4BrF5N2O2 — CID 103241784
5-bromo-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one (PubChem CID 103241784) has the molecular formula C7H4BrF5N2O2 and a molecular weight of 323.02 g/mol. Its IUPAC name is 5-bromo-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241784 |
| Molecular Formula | C7H4BrF5N2O2 |
| Molecular Weight | 323.02 g/mol |
| Exact Mass | 321.94 |
| IUPAC Name | 5-bromo-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(OCC(F)(F)C(F)(F)F)c1Br |
| InChI | InChI=1S/C7H4BrF5N2O2/c8-3-4(16)14-2-15-5(3)17-1-6(9,10)7(11,12)13/h2H,1H2,(H,14,15,16) |
| InChIKey | OXIAQLMRBJZGBM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.02 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|