C8H7F5N2O2 — CID 103241790
2-methyl-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one (PubChem CID 103241790) has the molecular formula C8H7F5N2O2 and a molecular weight of 258.15 g/mol. Its IUPAC name is 2-methyl-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241790 |
| Molecular Formula | C8H7F5N2O2 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-methyl-4-(2,2,3,3,3-pentafluoropropoxy)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(OCC(F)(F)C(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C8H7F5N2O2/c1-4-14-5(16)2-6(15-4)17-3-7(9,10)8(11,12)13/h2H,3H2,1H3,(H,14,15,16) |
| InChIKey | PWKSOGFWWTWJOB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|