About 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one
5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one (PubChem CID 103241914) has the molecular formula C9H11F3N2O3
and a molecular weight of 252.19 g/mol. Its IUPAC name is 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one |
| PubChem CID | 103241914 |
| Molecular Formula | C9H11F3N2O3 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one |
| SMILES | COc1c(OCCCC(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C9H11F3N2O3/c1-16-6-7(15)13-5-14-8(6)17-4-2-3-9(10,11)12/h5H,2-4H2,1H3,(H,13,14,15) |
| InChIKey | VHBIUGBDFLPNEI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one?
The IUPAC name of 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one (CID 103241914) is 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one?
The canonical SMILES for 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one is COc1c(OCCCC(F)(F)F)nc[nH]c1=O.
What is the InChIKey of 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one?
The InChIKey is VHBIUGBDFLPNEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2O3/c1-16-6-7(15)13-5-14-8(6)17-4-2-3-9(10,11)12/h5H,2-4H2,1H3,(H,13,14,15).
What are the key properties of 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one?
5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one has a molecular weight of 252.19 g/mol, XLogP of 1.50, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-4-(4,4,4-trifluorobutoxy)-1H-pyrimidin-6-one is sourced from PubChem (CID 103241914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).