C20H26F5N3O5S — CID 10324210
N-hydroxy-4-[4-[6-(3,3,4,4,4-pentafluorobutyl)-3-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 10324210) has the molecular formula C20H26F5N3O5S and a molecular weight of 515.50 g/mol. Its IUPAC name is N-hydroxy-4-[4-[6-(3,3,4,4,4-pentafluorobutyl)-3-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[6-(3,3,4,4,4-pentafluorobutyl)-3-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10324210 |
| Molecular Formula | C20H26F5N3O5S |
| Molecular Weight | 515.50 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | N-hydroxy-4-[4-[6-(3,3,4,4,4-pentafluorobutyl)-3-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(c3ccc(CCC(F)(F)C(F)(F)F)nc3)CC2)CCOCC1 |
| InChI | InChI=1S/C20H26F5N3O5S/c21-19(22,20(23,24)25)6-3-16-2-1-15(13-26-16)14-4-9-28(10-5-14)34(31,32)18(17(29)27-30)7-11-33-12-8-18/h1-2,13-14,30H,3-12H2,(H,27,29) |
| InChIKey | ZBJNITNHSUTGTF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|