(E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid

C8H15NO2 — CID 103242855

IUPAC(E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid
SMILESCC(C)(C)CN/C=C/C(=O)O
InChIInChI=1S/C8H15NO2/c1-8(2,3)6-9-5-4-7(10)11/h4-5,9H,6H2,1-3H3,(H,10,11)/b5-4+
InChIKeyKZYQTXLMTFMAQU-SNAWJCMRSA-N
MW157.21 g/mol
LogP1.22
Rot. Bonds3

About (E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid

(E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid (PubChem CID 103242855) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid
PubChem CID103242855
Molecular FormulaC8H15NO2
Molecular Weight157.21 g/mol
Exact Mass157.11
IUPAC Name(E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid
SMILESCC(C)(C)CN/C=C/C(=O)O
InChIInChI=1S/C8H15NO2/c1-8(2,3)6-9-5-4-7(10)11/h4-5,9H,6H2,1-3H3,(H,10,11)/b5-4+
InChIKeyKZYQTXLMTFMAQU-SNAWJCMRSA-N
XLogP1.22
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.21
LogP ≤ 51.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid?
The IUPAC name of (E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid (CID 103242855) is (E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid?
The canonical SMILES for (E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid is CC(C)(C)CN/C=C/C(=O)O.
What is the InChIKey of (E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid?
The InChIKey is KZYQTXLMTFMAQU-SNAWJCMRSA-N. The full InChI is InChI=1S/C8H15NO2/c1-8(2,3)6-9-5-4-7(10)11/h4-5,9H,6H2,1-3H3,(H,10,11)/b5-4+.
What are the key properties of (E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid?
(E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid has a molecular weight of 157.21 g/mol, XLogP of 1.22, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2,2-dimethylpropylamino)prop-2-enoic acid is sourced from PubChem (CID 103242855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).