C14H19NO3 — CID 103242898
2-[[1-(4-methylphenoxy)propan-2-ylamino]methyl]prop-2-enoic acid (PubChem CID 103242898) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-[[1-(4-methylphenoxy)propan-2-ylamino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[1-(4-methylphenoxy)propan-2-ylamino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103242898 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-[[1-(4-methylphenoxy)propan-2-ylamino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNC(C)COc1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C14H19NO3/c1-10-4-6-13(7-5-10)18-9-12(3)15-8-11(2)14(16)17/h4-7,12,15H,2,8-9H2,1,3H3,(H,16,17) |
| InChIKey | GXGHNAIUUHRYNU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|