C14H16N2O3S — CID 103243274
3-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethoxy]benzoic acid (PubChem CID 103243274) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethoxy]benzoic acid.
| Compound Name | 3-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 103243274 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethoxy]benzoic acid |
| SMILES | Cc1ncc(CNCCOc2cccc(C(=O)O)c2)s1 |
| InChI | InChI=1S/C14H16N2O3S/c1-10-16-9-13(20-10)8-15-5-6-19-12-4-2-3-11(7-12)14(17)18/h2-4,7,9,15H,5-6,8H2,1H3,(H,17,18) |
| InChIKey | JSNOJDSSKVQHOI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|