C28H33N5O5 — CID 10324361
methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-(1,2-oxazol-5-ylmethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate (PubChem CID 10324361) has the molecular formula C28H33N5O5 and a molecular weight of 519.60 g/mol. Its IUPAC name is methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-(1,2-oxazol-5-ylmethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-(1,2-oxazol-5-ylmethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 10324361 |
| Molecular Formula | C28H33N5O5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | methyl 4-[[2-butyl-5-[(Z)-[1-butyl-3-(1,2-oxazol-5-ylmethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]imidazol-1-yl]methyl]benzoate |
| SMILES | CCCCc1ncc(/C=C2/C(=O)N(CCCC)C(=O)N2Cc2ccno2)n1Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C28H33N5O5/c1-4-6-8-25-29-17-22(32(25)18-20-9-11-21(12-10-20)27(35)37-3)16-24-26(34)31(15-7-5-2)28(36)33(24)19-23-13-14-30-38-23/h9-14,16-17H,4-8,15,18-19H2,1-3H3/b24-16- |
| InChIKey | BWQUWUIRBWFDHQ-JLPGSUDCSA-N |
| XLogP | 4.65 |
| TPSA | 110.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|