C18F16 — CID 10324378
1,2,3,4,5-pentafluoro-6-[1,1,1,6,6,6-hexafluoro-5-(2,3,4,5,6-pentafluorophenyl)hexa-2,3,4-trien-2-yl]benzene (PubChem CID 10324378) has the molecular formula C18F16 and a molecular weight of 520.17 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[1,1,1,6,6,6-hexafluoro-5-(2,3,4,5,6-pentafluorophenyl)hexa-2,3,4-trien-2-yl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[1,1,1,6,6,6-hexafluoro-5-(2,3,4,5,6-pentafluorophenyl)hexa-2,3,4-trien-2-yl]benzene |
|---|---|
| PubChem CID | 10324378 |
| Molecular Formula | C18F16 |
| Molecular Weight | 520.17 g/mol |
| Exact Mass | 519.97 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[1,1,1,6,6,6-hexafluoro-5-(2,3,4,5,6-pentafluorophenyl)hexa-2,3,4-trien-2-yl]benzene |
| SMILES | Fc1c(F)c(F)c(C(=C=C=C(c2c(F)c(F)c(F)c(F)c2F)C(F)(F)F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C18F16/c19-7-5(8(20)12(24)15(27)11(7)23)3(17(29,30)31)1-2-4(18(32,33)34)6-9(21)13(25)16(28)14(26)10(6)22/b4-3+ |
| InChIKey | ZLNGJPKMQUXQHN-ONEGZZNKSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.17 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|