About propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate
propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate (PubChem CID 10324429) has the molecular formula C31H43N3O2S
and a molecular weight of 521.77 g/mol. Its IUPAC name is propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate.
Molecular Properties
| Compound Name | propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate |
| PubChem CID | 10324429 |
| Molecular Formula | C31H43N3O2S |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate |
| SMILES | CCCCCCCN(CCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)OCCC |
| InChI | InChI=1S/C31H43N3O2S/c1-3-5-6-7-15-22-34(31(35)36-24-4-2)23-16-10-17-25-37-30-32-28(26-18-11-8-12-19-26)29(33-30)27-20-13-9-14-21-27/h8-9,11-14,18-21H,3-7,10,15-17,22-25H2,1-2H3,(H,32,33) |
| InChIKey | ARSRVPYYZBFMRY-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate?
The IUPAC name of propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate (CID 10324429) is propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate.
What is the SMILES notation for propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate?
The canonical SMILES for propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate is CCCCCCCN(CCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)OCCC.
What is the InChIKey of propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate?
The InChIKey is ARSRVPYYZBFMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H43N3O2S/c1-3-5-6-7-15-22-34(31(35)36-24-4-2)23-16-10-17-25-37-30-32-28(26-18-11-8-12-19-26)29(33-30)27-20-13-9-14-21-27/h8-9,11-14,18-21H,3-7,10,15-17,22-25H2,1-2H3,(H,32,33).
What are the key properties of propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate?
propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate has a molecular weight of 521.77 g/mol, XLogP of 8.83, 17 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-N-heptylcarbamate is sourced from PubChem (CID 10324429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).