C12H20N2O2 — CID 103244988
2-[(1-cyclopropylpyrrolidin-3-yl)amino]cyclobutane-1-carboxylic acid (PubChem CID 103244988) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-[(1-cyclopropylpyrrolidin-3-yl)amino]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[(1-cyclopropylpyrrolidin-3-yl)amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 103244988 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-[(1-cyclopropylpyrrolidin-3-yl)amino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1NC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C12H20N2O2/c15-12(16)10-3-4-11(10)13-8-5-6-14(7-8)9-1-2-9/h8-11,13H,1-7H2,(H,15,16) |
| InChIKey | SSOLVLZXAKHWGB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |